C23H23ClO3 — CID 90697503
3-[5-(4-chlorophenyl)-2-methylphenyl]-4a-methyl-6,7,8,8a-tetrahydro-5H-chromene-2,4-dione (PubChem CID 90697503) has the molecular formula C23H23ClO3 and a molecular weight of 382.89 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)-2-methylphenyl]-4a-methyl-6,7,8,8a-tetrahydro-5H-chromene-2,4-dione.
| Compound Name | 3-[5-(4-chlorophenyl)-2-methylphenyl]-4a-methyl-6,7,8,8a-tetrahydro-5H-chromene-2,4-dione |
|---|---|
| PubChem CID | 90697503 |
| Molecular Formula | C23H23ClO3 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 3-[5-(4-chlorophenyl)-2-methylphenyl]-4a-methyl-6,7,8,8a-tetrahydro-5H-chromene-2,4-dione |
| SMILES | Cc1ccc(-c2ccc(Cl)cc2)cc1C1C(=O)OC2CCCCC2(C)C1=O |
| InChI | InChI=1S/C23H23ClO3/c1-14-6-7-16(15-8-10-17(24)11-9-15)13-18(14)20-21(25)23(2)12-4-3-5-19(23)27-22(20)26/h6-11,13,19-20H,3-5,12H2,1-2H3 |
| InChIKey | LCISMGQTUYANPE-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|