About 1-[4-[hydroxy(dimethyl)-λ4-sulfanyl]-2-methylcyclopenta-1,3-dien-1-yl]ethanone
1-[4-[hydroxy(dimethyl)-λ4-sulfanyl]-2-methylcyclopenta-1,3-dien-1-yl]ethanone (PubChem CID 90697675) has the molecular formula C10H16O2S
and a molecular weight of 200.30 g/mol. Its IUPAC name is 1-[4-[hydroxy(dimethyl)-λ4-sulfanyl]-2-methylcyclopenta-1,3-dien-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-[hydroxy(dimethyl)-λ4-sulfanyl]-2-methylcyclopenta-1,3-dien-1-yl]ethanone |
| PubChem CID | 90697675 |
| Molecular Formula | C10H16O2S |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 1-[4-[hydroxy(dimethyl)-λ4-sulfanyl]-2-methylcyclopenta-1,3-dien-1-yl]ethanone |
| SMILES | CC(=O)C1=C(C)C=C(S(C)(C)O)C1 |
| InChI | InChI=1S/C10H16O2S/c1-7-5-9(13(3,4)12)6-10(7)8(2)11/h5,12H,6H2,1-4H3 |
| InChIKey | KYTGORRQBIHFNC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[4-[hydroxy(dimethyl)-λ4-sulfanyl]-2-methylcyclopenta-1,3-dien-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[hydroxy(dimethyl)-λ4-sulfanyl]-2-methylcyclopenta-1,3-dien-1-yl]ethanone?
The IUPAC name of 1-[4-[hydroxy(dimethyl)-λ4-sulfanyl]-2-methylcyclopenta-1,3-dien-1-yl]ethanone (CID 90697675) is 1-[4-[hydroxy(dimethyl)-λ4-sulfanyl]-2-methylcyclopenta-1,3-dien-1-yl]ethanone.
What is the SMILES notation for 1-[4-[hydroxy(dimethyl)-λ4-sulfanyl]-2-methylcyclopenta-1,3-dien-1-yl]ethanone?
The canonical SMILES for 1-[4-[hydroxy(dimethyl)-λ4-sulfanyl]-2-methylcyclopenta-1,3-dien-1-yl]ethanone is CC(=O)C1=C(C)C=C(S(C)(C)O)C1.
What is the InChIKey of 1-[4-[hydroxy(dimethyl)-λ4-sulfanyl]-2-methylcyclopenta-1,3-dien-1-yl]ethanone?
The InChIKey is KYTGORRQBIHFNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2S/c1-7-5-9(13(3,4)12)6-10(7)8(2)11/h5,12H,6H2,1-4H3.
What are the key properties of 1-[4-[hydroxy(dimethyl)-λ4-sulfanyl]-2-methylcyclopenta-1,3-dien-1-yl]ethanone?
1-[4-[hydroxy(dimethyl)-λ4-sulfanyl]-2-methylcyclopenta-1,3-dien-1-yl]ethanone has a molecular weight of 200.30 g/mol, XLogP of 2.72, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[hydroxy(dimethyl)-λ4-sulfanyl]-2-methylcyclopenta-1,3-dien-1-yl]ethanone is sourced from PubChem (CID 90697675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).