C11H19N — CID 90697914
3,4-bis(ethenyl)-N-methylcyclohexan-1-amine (PubChem CID 90697914) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 3,4-bis(ethenyl)-N-methylcyclohexan-1-amine.
| Compound Name | 3,4-bis(ethenyl)-N-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 90697914 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 3,4-bis(ethenyl)-N-methylcyclohexan-1-amine |
| SMILES | C=CC1CCC(NC)CC1C=C |
| InChI | InChI=1S/C11H19N/c1-4-9-6-7-11(12-3)8-10(9)5-2/h4-5,9-12H,1-2,6-8H2,3H3 |
| InChIKey | VERLXSVEZQISQZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|