About 5-ethenyl-4-hydroxy-3-methyl-1,3-thiazol-2-one
5-ethenyl-4-hydroxy-3-methyl-1,3-thiazol-2-one (PubChem CID 90698986) has the molecular formula C6H7NO2S
and a molecular weight of 157.19 g/mol. Its IUPAC name is 5-ethenyl-4-hydroxy-3-methyl-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 5-ethenyl-4-hydroxy-3-methyl-1,3-thiazol-2-one |
| PubChem CID | 90698986 |
| Molecular Formula | C6H7NO2S |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.02 |
| IUPAC Name | 5-ethenyl-4-hydroxy-3-methyl-1,3-thiazol-2-one |
| SMILES | C=Cc1sc(=O)n(C)c1O |
| InChI | InChI=1S/C6H7NO2S/c1-3-4-5(8)7(2)6(9)10-4/h3,8H,1H2,2H3 |
| InChIKey | FQTHRFPZLCKIJM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-ethenyl-4-hydroxy-3-methyl-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-4-hydroxy-3-methyl-1,3-thiazol-2-one?
The IUPAC name of 5-ethenyl-4-hydroxy-3-methyl-1,3-thiazol-2-one (CID 90698986) is 5-ethenyl-4-hydroxy-3-methyl-1,3-thiazol-2-one.
What is the SMILES notation for 5-ethenyl-4-hydroxy-3-methyl-1,3-thiazol-2-one?
The canonical SMILES for 5-ethenyl-4-hydroxy-3-methyl-1,3-thiazol-2-one is C=Cc1sc(=O)n(C)c1O.
What is the InChIKey of 5-ethenyl-4-hydroxy-3-methyl-1,3-thiazol-2-one?
The InChIKey is FQTHRFPZLCKIJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2S/c1-3-4-5(8)7(2)6(9)10-4/h3,8H,1H2,2H3.
What are the key properties of 5-ethenyl-4-hydroxy-3-methyl-1,3-thiazol-2-one?
5-ethenyl-4-hydroxy-3-methyl-1,3-thiazol-2-one has a molecular weight of 157.19 g/mol, XLogP of 0.80, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-4-hydroxy-3-methyl-1,3-thiazol-2-one is sourced from PubChem (CID 90698986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).