C17H17NOS — CID 9069905
(E)-N-(2,3-dimethylphenyl)-3-phenylsulfanylprop-2-enamide (PubChem CID 9069905) has the molecular formula C17H17NOS and a molecular weight of 283.40 g/mol. Its IUPAC name is (E)-N-(2,3-dimethylphenyl)-3-phenylsulfanylprop-2-enamide.
| Compound Name | (E)-N-(2,3-dimethylphenyl)-3-phenylsulfanylprop-2-enamide |
|---|---|
| PubChem CID | 9069905 |
| Molecular Formula | C17H17NOS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (E)-N-(2,3-dimethylphenyl)-3-phenylsulfanylprop-2-enamide |
| SMILES | Cc1cccc(NC(=O)/C=C/Sc2ccccc2)c1C |
| InChI | InChI=1S/C17H17NOS/c1-13-7-6-10-16(14(13)2)18-17(19)11-12-20-15-8-4-3-5-9-15/h3-12H,1-2H3,(H,18,19)/b12-11+ |
| InChIKey | BTAGDEZVIBQLHI-VAWYXSNFSA-N |
| XLogP | 4.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|