C22H8F10N2O10S2 — CID 90699424
[1,3,5,7-tetrahydroxy-2-(2,3,4,5,6-pentafluorophenyl)sulfonyloxy-4,8-dihydropyrrolo[3,4-f]isoindol-6-yl] 2,3,4,5,6-pentafluorobenzenesulfonate (PubChem CID 90699424) has the molecular formula C22H8F10N2O10S2 and a molecular weight of 714.42 g/mol. Its IUPAC name is [1,3,5,7-tetrahydroxy-2-(2,3,4,5,6-pentafluorophenyl)sulfonyloxy-4,8-dihydropyrrolo[3,4-f]isoindol-6-yl] 2,3,4,5,6-pentafluorobenzenesulfonate.
| Compound Name | [1,3,5,7-tetrahydroxy-2-(2,3,4,5,6-pentafluorophenyl)sulfonyloxy-4,8-dihydropyrrolo[3,4-f]isoindol-6-yl] 2,3,4,5,6-pentafluorobenzenesulfonate |
|---|---|
| PubChem CID | 90699424 |
| Molecular Formula | C22H8F10N2O10S2 |
| Molecular Weight | 714.42 g/mol |
| Exact Mass | 713.95 |
| IUPAC Name | [1,3,5,7-tetrahydroxy-2-(2,3,4,5,6-pentafluorophenyl)sulfonyloxy-4,8-dihydropyrrolo[3,4-f]isoindol-6-yl] 2,3,4,5,6-pentafluorobenzenesulfonate |
| SMILES | O=S(=O)(On1c(O)c2c(c1O)Cc1c(c(O)n(OS(=O)(=O)c3c(F)c(F)c(F)c(F)c3F)c1O)C2)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C22H8F10N2O10S2/c23-7-9(25)13(29)17(14(30)10(7)26)45(39,40)43-33-19(35)3-1-4-6(2-5(3)21(33)37)22(38)34(20(4)36)44-46(41,42)18-15(31)11(27)8(24)12(28)16(18)32/h35-38H,1-2H2 |
| InChIKey | YCVKQYKDUNDIME-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 177.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|