C24H28O4 — CID 90699582
[2-oxo-2-[(10R,13S)-6,10,13-trimethyl-3-oxo-4,7,8,12,14,15-hexahydrocyclopenta[a]phenanthren-17-yl]ethyl] acetate (PubChem CID 90699582) has the molecular formula C24H28O4 and a molecular weight of 380.48 g/mol. Its IUPAC name is [2-oxo-2-[(10R,13S)-6,10,13-trimethyl-3-oxo-4,7,8,12,14,15-hexahydrocyclopenta[a]phenanthren-17-yl]ethyl] acetate.
| Compound Name | [2-oxo-2-[(10R,13S)-6,10,13-trimethyl-3-oxo-4,7,8,12,14,15-hexahydrocyclopenta[a]phenanthren-17-yl]ethyl] acetate |
|---|---|
| PubChem CID | 90699582 |
| Molecular Formula | C24H28O4 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | [2-oxo-2-[(10R,13S)-6,10,13-trimethyl-3-oxo-4,7,8,12,14,15-hexahydrocyclopenta[a]phenanthren-17-yl]ethyl] acetate |
| SMILES | CC(=O)OCC(=O)C1=CCC2C3CC(C)=C4CC(=O)C=C[C@]4(C)C3=CC[C@]12C |
| InChI | InChI=1S/C24H28O4/c1-14-11-17-18-5-6-20(22(27)13-28-15(2)25)23(18,3)10-8-19(17)24(4)9-7-16(26)12-21(14)24/h6-9,17-18H,5,10-13H2,1-4H3/t17?,18?,23-,24+/m0/s1 |
| InChIKey | AOXLNZUTWVPOLD-QCAUPAFHSA-N |
| XLogP | 4.27 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|