C27H21FN2O2 — CID 90700030
2-[[4-(4-fluorophenoxy)phenyl]methyl]-7-methyl-5-pyridin-2-ylisoindol-1-ol (PubChem CID 90700030) has the molecular formula C27H21FN2O2 and a molecular weight of 424.48 g/mol. Its IUPAC name is 2-[[4-(4-fluorophenoxy)phenyl]methyl]-7-methyl-5-pyridin-2-ylisoindol-1-ol.
| Compound Name | 2-[[4-(4-fluorophenoxy)phenyl]methyl]-7-methyl-5-pyridin-2-ylisoindol-1-ol |
|---|---|
| PubChem CID | 90700030 |
| Molecular Formula | C27H21FN2O2 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 2-[[4-(4-fluorophenoxy)phenyl]methyl]-7-methyl-5-pyridin-2-ylisoindol-1-ol |
| SMILES | Cc1cc(-c2ccccn2)cc2cn(Cc3ccc(Oc4ccc(F)cc4)cc3)c(O)c12 |
| InChI | InChI=1S/C27H21FN2O2/c1-18-14-20(25-4-2-3-13-29-25)15-21-17-30(27(31)26(18)21)16-19-5-9-23(10-6-19)32-24-11-7-22(28)8-12-24/h2-15,17,31H,16H2,1H3 |
| InChIKey | MUWJCJUTWZZKSC-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |