C22H16F3N3O5 — CID 90700045
(5R)-5-[[6-(difluoromethoxy)-1-hydroxyisoindol-2-yl]methyl]-5-[2-(3-fluoro-4-methoxyphenyl)ethynyl]imidazolidine-2,4-dione (PubChem CID 90700045) has the molecular formula C22H16F3N3O5 and a molecular weight of 459.38 g/mol. Its IUPAC name is (5R)-5-[[6-(difluoromethoxy)-1-hydroxyisoindol-2-yl]methyl]-5-[2-(3-fluoro-4-methoxyphenyl)ethynyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[[6-(difluoromethoxy)-1-hydroxyisoindol-2-yl]methyl]-5-[2-(3-fluoro-4-methoxyphenyl)ethynyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 90700045 |
| Molecular Formula | C22H16F3N3O5 |
| Molecular Weight | 459.38 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | (5R)-5-[[6-(difluoromethoxy)-1-hydroxyisoindol-2-yl]methyl]-5-[2-(3-fluoro-4-methoxyphenyl)ethynyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc(C#C[C@]2(Cn3cc4ccc(OC(F)F)cc4c3O)NC(=O)NC2=O)cc1F |
| InChI | InChI=1S/C22H16F3N3O5/c1-32-17-5-2-12(8-16(17)23)6-7-22(19(30)26-21(31)27-22)11-28-10-13-3-4-14(33-20(24)25)9-15(13)18(28)29/h2-5,8-10,20,29H,11H2,1H3,(H2,26,27,30,31)/t22-/m1/s1 |
| InChIKey | FGKADQKKCVUCSN-JOCHJYFZSA-N |
| XLogP | 2.73 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|