About 1-[4-(1-ethoxyethoxy)phenyl]-3,4-dimethylpyrrole-2,5-diol
1-[4-(1-ethoxyethoxy)phenyl]-3,4-dimethylpyrrole-2,5-diol (PubChem CID 90700253) has the molecular formula C16H21NO4
and a molecular weight of 291.35 g/mol. Its IUPAC name is 1-[4-(1-ethoxyethoxy)phenyl]-3,4-dimethylpyrrole-2,5-diol.
Molecular Properties
| Compound Name | 1-[4-(1-ethoxyethoxy)phenyl]-3,4-dimethylpyrrole-2,5-diol |
| PubChem CID | 90700253 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 1-[4-(1-ethoxyethoxy)phenyl]-3,4-dimethylpyrrole-2,5-diol |
| SMILES | CCOC(C)Oc1ccc(-n2c(O)c(C)c(C)c2O)cc1 |
| InChI | InChI=1S/C16H21NO4/c1-5-20-12(4)21-14-8-6-13(7-9-14)17-15(18)10(2)11(3)16(17)19/h6-9,12,18-19H,5H2,1-4H3 |
| InChIKey | GMWGZMFUZDYWLV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 63.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(1-ethoxyethoxy)phenyl]-3,4-dimethylpyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(1-ethoxyethoxy)phenyl]-3,4-dimethylpyrrole-2,5-diol?
The IUPAC name of 1-[4-(1-ethoxyethoxy)phenyl]-3,4-dimethylpyrrole-2,5-diol (CID 90700253) is 1-[4-(1-ethoxyethoxy)phenyl]-3,4-dimethylpyrrole-2,5-diol.
What is the SMILES notation for 1-[4-(1-ethoxyethoxy)phenyl]-3,4-dimethylpyrrole-2,5-diol?
The canonical SMILES for 1-[4-(1-ethoxyethoxy)phenyl]-3,4-dimethylpyrrole-2,5-diol is CCOC(C)Oc1ccc(-n2c(O)c(C)c(C)c2O)cc1.
What is the InChIKey of 1-[4-(1-ethoxyethoxy)phenyl]-3,4-dimethylpyrrole-2,5-diol?
The InChIKey is GMWGZMFUZDYWLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO4/c1-5-20-12(4)21-14-8-6-13(7-9-14)17-15(18)10(2)11(3)16(17)19/h6-9,12,18-19H,5H2,1-4H3.
What are the key properties of 1-[4-(1-ethoxyethoxy)phenyl]-3,4-dimethylpyrrole-2,5-diol?
1-[4-(1-ethoxyethoxy)phenyl]-3,4-dimethylpyrrole-2,5-diol has a molecular weight of 291.35 g/mol, XLogP of 3.27, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(1-ethoxyethoxy)phenyl]-3,4-dimethylpyrrole-2,5-diol is sourced from PubChem (CID 90700253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).