C13H14O8 — CID 90700356
5-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 90700356) has the molecular formula C13H14O8 and a molecular weight of 298.25 g/mol. Its IUPAC name is 5-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 90700356 |
| Molecular Formula | C13H14O8 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 5-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=CC2C(=O)OC(C)(C)OC2=O)C(=O)O1 |
| InChI | InChI=1S/C13H14O8/c1-12(2)18-8(14)6(9(15)19-12)5-7-10(16)20-13(3,4)21-11(7)17/h5-6H,1-4H3 |
| InChIKey | RWJISUASECEJGI-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|