About 3-(butylamino)-1H-pyrrole-2,5-diol
3-(butylamino)-1H-pyrrole-2,5-diol (PubChem CID 90700545) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is 3-(butylamino)-1H-pyrrole-2,5-diol.
Molecular Properties
| Compound Name | 3-(butylamino)-1H-pyrrole-2,5-diol |
| PubChem CID | 90700545 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 3-(butylamino)-1H-pyrrole-2,5-diol |
| SMILES | CCCCNc1cc(O)[nH]c1O |
| InChI | InChI=1S/C8H14N2O2/c1-2-3-4-9-6-5-7(11)10-8(6)12/h5,9-12H,2-4H2,1H3 |
| InChIKey | NGSBNRPQXGGUTO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 68.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(butylamino)-1H-pyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(butylamino)-1H-pyrrole-2,5-diol?
The IUPAC name of 3-(butylamino)-1H-pyrrole-2,5-diol (CID 90700545) is 3-(butylamino)-1H-pyrrole-2,5-diol.
What is the SMILES notation for 3-(butylamino)-1H-pyrrole-2,5-diol?
The canonical SMILES for 3-(butylamino)-1H-pyrrole-2,5-diol is CCCCNc1cc(O)[nH]c1O.
What is the InChIKey of 3-(butylamino)-1H-pyrrole-2,5-diol?
The InChIKey is NGSBNRPQXGGUTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2/c1-2-3-4-9-6-5-7(11)10-8(6)12/h5,9-12H,2-4H2,1H3.
What are the key properties of 3-(butylamino)-1H-pyrrole-2,5-diol?
3-(butylamino)-1H-pyrrole-2,5-diol has a molecular weight of 170.21 g/mol, XLogP of 1.64, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(butylamino)-1H-pyrrole-2,5-diol is sourced from PubChem (CID 90700545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).