C14H22 — CID 90700641
3-methyl-2,3,7,8,9,10,11,11a-octahydro-1H-cyclopenta[10]annulene (PubChem CID 90700641) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is 3-methyl-2,3,7,8,9,10,11,11a-octahydro-1H-cyclopenta[10]annulene.
| Compound Name | 3-methyl-2,3,7,8,9,10,11,11a-octahydro-1H-cyclopenta[10]annulene |
|---|---|
| PubChem CID | 90700641 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 3-methyl-2,3,7,8,9,10,11,11a-octahydro-1H-cyclopenta[10]annulene |
| SMILES | CC1CCC2CCCCCC=CC=C12 |
| InChI | InChI=1S/C14H22/c1-12-10-11-13-8-6-4-2-3-5-7-9-14(12)13/h5,7,9,12-13H,2-4,6,8,10-11H2,1H3 |
| InChIKey | UXTJIRRISWJBRO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |