C10H9N3 — CID 90700791
4,5,7-triazatetracyclo[6.3.2.02,11.03,7]trideca-3,5,9,12-tetraene (PubChem CID 90700791) has the molecular formula C10H9N3 and a molecular weight of 171.20 g/mol. Its IUPAC name is 4,5,7-triazatetracyclo[6.3.2.02,11.03,7]trideca-3,5,9,12-tetraene.
| Compound Name | 4,5,7-triazatetracyclo[6.3.2.02,11.03,7]trideca-3,5,9,12-tetraene |
|---|---|
| PubChem CID | 90700791 |
| Molecular Formula | C10H9N3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 4,5,7-triazatetracyclo[6.3.2.02,11.03,7]trideca-3,5,9,12-tetraene |
| SMILES | C1=CC2C=CC3C1C3c1nncn12 |
| InChI | InChI=1S/C10H9N3/c1-3-7-8-4-2-6(1)13-5-11-12-10(13)9(7)8/h1-9H |
| InChIKey | GTZFIFYVOAYPRK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|