C28H32ClN5O4 — CID 90701406
4-[4-[(5-chloro-2-ethoxyphenyl)carbamoylamino]phenyl]-N-(4-methoxy-2-methylphenyl)piperazine-1-carboxamide (PubChem CID 90701406) has the molecular formula C28H32ClN5O4 and a molecular weight of 538.05 g/mol. Its IUPAC name is 4-[4-[(5-chloro-2-ethoxyphenyl)carbamoylamino]phenyl]-N-(4-methoxy-2-methylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[4-[(5-chloro-2-ethoxyphenyl)carbamoylamino]phenyl]-N-(4-methoxy-2-methylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 90701406 |
| Molecular Formula | C28H32ClN5O4 |
| Molecular Weight | 538.05 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | 4-[4-[(5-chloro-2-ethoxyphenyl)carbamoylamino]phenyl]-N-(4-methoxy-2-methylphenyl)piperazine-1-carboxamide |
| SMILES | CCOc1ccc(Cl)cc1NC(=O)Nc1ccc(N2CCN(C(=O)Nc3ccc(OC)cc3C)CC2)cc1 |
| InChI | InChI=1S/C28H32ClN5O4/c1-4-38-26-12-5-20(29)18-25(26)31-27(35)30-21-6-8-22(9-7-21)33-13-15-34(16-14-33)28(36)32-24-11-10-23(37-3)17-19(24)2/h5-12,17-18H,4,13-16H2,1-3H3,(H,32,36)(H2,30,31,35) |
| InChIKey | ZTDYYLPOODJLSJ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.05 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|