C15H13BrF2N2S — CID 90702635
1-(3-bromopropyl)-3-(2,6-difluorophenyl)-2,1,3-benzothiadiazole (PubChem CID 90702635) has the molecular formula C15H13BrF2N2S and a molecular weight of 371.25 g/mol. Its IUPAC name is 1-(3-bromopropyl)-3-(2,6-difluorophenyl)-2,1,3-benzothiadiazole.
| Compound Name | 1-(3-bromopropyl)-3-(2,6-difluorophenyl)-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 90702635 |
| Molecular Formula | C15H13BrF2N2S |
| Molecular Weight | 371.25 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | 1-(3-bromopropyl)-3-(2,6-difluorophenyl)-2,1,3-benzothiadiazole |
| SMILES | Fc1cccc(F)c1N1SN(CCCBr)c2ccccc21 |
| InChI | InChI=1S/C15H13BrF2N2S/c16-9-4-10-19-13-7-1-2-8-14(13)20(21-19)15-11(17)5-3-6-12(15)18/h1-3,5-8H,4,9-10H2 |
| InChIKey | BFFLQLMJPXXKQJ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.25 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|