About 1-(azepan-1-yl)-2-bromopropane-1,3-diimine
1-(azepan-1-yl)-2-bromopropane-1,3-diimine (PubChem CID 90702658) has the molecular formula C9H16BrN3
and a molecular weight of 246.15 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-bromopropane-1,3-diimine.
Molecular Properties
| Compound Name | 1-(azepan-1-yl)-2-bromopropane-1,3-diimine |
| PubChem CID | 90702658 |
| Molecular Formula | C9H16BrN3 |
| Molecular Weight | 246.15 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 1-(azepan-1-yl)-2-bromopropane-1,3-diimine |
| SMILES | [H]/N=C/C(Br)/C(=N\[H])N1CCCCCC1 |
| InChI | InChI=1S/C9H16BrN3/c10-8(7-11)9(12)13-5-3-1-2-4-6-13/h7-8,11-12H,1-6H2/b11-7+,12-9+ |
| InChIKey | HYXBBCPFEAYMSE-HNWKWBPYSA-N |
| XLogP | 2.25 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.15 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(azepan-1-yl)-2-bromopropane-1,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(azepan-1-yl)-2-bromopropane-1,3-diimine?
The IUPAC name of 1-(azepan-1-yl)-2-bromopropane-1,3-diimine (CID 90702658) is 1-(azepan-1-yl)-2-bromopropane-1,3-diimine.
What is the SMILES notation for 1-(azepan-1-yl)-2-bromopropane-1,3-diimine?
The canonical SMILES for 1-(azepan-1-yl)-2-bromopropane-1,3-diimine is [H]/N=C/C(Br)/C(=N\[H])N1CCCCCC1.
What is the InChIKey of 1-(azepan-1-yl)-2-bromopropane-1,3-diimine?
The InChIKey is HYXBBCPFEAYMSE-HNWKWBPYSA-N. The full InChI is InChI=1S/C9H16BrN3/c10-8(7-11)9(12)13-5-3-1-2-4-6-13/h7-8,11-12H,1-6H2/b11-7+,12-9+.
What are the key properties of 1-(azepan-1-yl)-2-bromopropane-1,3-diimine?
1-(azepan-1-yl)-2-bromopropane-1,3-diimine has a molecular weight of 246.15 g/mol, XLogP of 2.25, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(azepan-1-yl)-2-bromopropane-1,3-diimine is sourced from PubChem (CID 90702658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).