C9H16BrN3 — CID 90702658
1-(azepan-1-yl)-2-bromopropane-1,3-diimine (PubChem CID 90702658) has the molecular formula C9H16BrN3 and a molecular weight of 246.15 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-bromopropane-1,3-diimine.
| Compound Name | 1-(azepan-1-yl)-2-bromopropane-1,3-diimine |
|---|---|
| PubChem CID | 90702658 |
| Molecular Formula | C9H16BrN3 |
| Molecular Weight | 246.15 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 1-(azepan-1-yl)-2-bromopropane-1,3-diimine |
| SMILES | [H]/N=C/C(Br)/C(=N\[H])N1CCCCCC1 |
| InChI | InChI=1S/C9H16BrN3/c10-8(7-11)9(12)13-5-3-1-2-4-6-13/h7-8,11-12H,1-6H2/b11-7+,12-9+ |
| InChIKey | HYXBBCPFEAYMSE-HNWKWBPYSA-N |
| XLogP | 2.25 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.15 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|