C20H31NO5 — CID 90702845
(3S,6R,7S,7aS)-3-tert-butyl-7a-(cyclohexene-1-carbonyl)-7-hydroxy-6-(2-hydroxyethyl)-7-methyl-3,6-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 90702845) has the molecular formula C20H31NO5 and a molecular weight of 365.47 g/mol. Its IUPAC name is (3S,6R,7S,7aS)-3-tert-butyl-7a-(cyclohexene-1-carbonyl)-7-hydroxy-6-(2-hydroxyethyl)-7-methyl-3,6-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (3S,6R,7S,7aS)-3-tert-butyl-7a-(cyclohexene-1-carbonyl)-7-hydroxy-6-(2-hydroxyethyl)-7-methyl-3,6-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 90702845 |
| Molecular Formula | C20H31NO5 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | (3S,6R,7S,7aS)-3-tert-butyl-7a-(cyclohexene-1-carbonyl)-7-hydroxy-6-(2-hydroxyethyl)-7-methyl-3,6-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | CC(C)(C)[C@@H]1OC[C@]2(C(=O)C3=CCCCC3)N1C(=O)[C@H](CCO)[C@]2(C)O |
| InChI | InChI=1S/C20H31NO5/c1-18(2,3)17-21-16(24)14(10-11-22)19(4,25)20(21,12-26-17)15(23)13-8-6-5-7-9-13/h8,14,17,22,25H,5-7,9-12H2,1-4H3/t14-,17-,19-,20+/m0/s1 |
| InChIKey | YYSUMGATTIRWND-GALXQHASSA-N |
| XLogP | 1.79 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |