C10H6F2O6 — CID 90703261
1,7-difluoro-2,6-dimethyl-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone (PubChem CID 90703261) has the molecular formula C10H6F2O6 and a molecular weight of 260.15 g/mol. Its IUPAC name is 1,7-difluoro-2,6-dimethyl-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone.
| Compound Name | 1,7-difluoro-2,6-dimethyl-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone |
|---|---|
| PubChem CID | 90703261 |
| Molecular Formula | C10H6F2O6 |
| Molecular Weight | 260.15 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | 1,7-difluoro-2,6-dimethyl-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone |
| SMILES | CC12C(=O)OC(=O)C1(C)C1(F)C(=O)OC(=O)C21F |
| InChI | InChI=1S/C10H6F2O6/c1-7-3(13)17-4(14)8(7,2)10(12)6(16)18-5(15)9(7,10)11/h1-2H3 |
| InChIKey | VHWMVYBRRBGNBP-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.15 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|