About 9-methyl-3,4,6,7-tetrahydro-2H-cyclohepta[b]pyridine
9-methyl-3,4,6,7-tetrahydro-2H-cyclohepta[b]pyridine (PubChem CID 90703386) has the molecular formula C11H15N
and a molecular weight of 161.25 g/mol. Its IUPAC name is 9-methyl-3,4,6,7-tetrahydro-2H-cyclohepta[b]pyridine.
Analyze 9-methyl-3,4,6,7-tetrahydro-2H-cyclohepta[b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-3,4,6,7-tetrahydro-2H-cyclohepta[b]pyridine?
The IUPAC name of 9-methyl-3,4,6,7-tetrahydro-2H-cyclohepta[b]pyridine (CID 90703386) is 9-methyl-3,4,6,7-tetrahydro-2H-cyclohepta[b]pyridine.
What is the SMILES notation for 9-methyl-3,4,6,7-tetrahydro-2H-cyclohepta[b]pyridine?
The canonical SMILES for 9-methyl-3,4,6,7-tetrahydro-2H-cyclohepta[b]pyridine is CC1=CCCC=C2CCCN=C12.
What is the InChIKey of 9-methyl-3,4,6,7-tetrahydro-2H-cyclohepta[b]pyridine?
The InChIKey is SIECQELQZJPJGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N/c1-9-5-2-3-6-10-7-4-8-12-11(9)10/h5-6H,2-4,7-8H2,1H3.
What are the key properties of 9-methyl-3,4,6,7-tetrahydro-2H-cyclohepta[b]pyridine?
9-methyl-3,4,6,7-tetrahydro-2H-cyclohepta[b]pyridine has a molecular weight of 161.25 g/mol, XLogP of 2.89, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-3,4,6,7-tetrahydro-2H-cyclohepta[b]pyridine is sourced from PubChem (CID 90703386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).