About 3,4-bis[2-(2,4-difluorophenyl)-3-pyridinyl]pyridine-2-carboxylic acid
3,4-bis[2-(2,4-difluorophenyl)-3-pyridinyl]pyridine-2-carboxylic acid (PubChem CID 90703679) has the molecular formula C28H15F4N3O2
and a molecular weight of 501.44 g/mol. Its IUPAC name is 3,4-bis[2-(2,4-difluorophenyl)-3-pyridinyl]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 3,4-bis[2-(2,4-difluorophenyl)-3-pyridinyl]pyridine-2-carboxylic acid |
| PubChem CID | 90703679 |
| Molecular Formula | C28H15F4N3O2 |
| Molecular Weight | 501.44 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | 3,4-bis[2-(2,4-difluorophenyl)-3-pyridinyl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1nccc(-c2cccnc2-c2ccc(F)cc2F)c1-c1cccnc1-c1ccc(F)cc1F |
| InChI | InChI=1S/C28H15F4N3O2/c29-15-5-7-19(22(31)13-15)25-18(3-1-10-33-25)17-9-12-35-27(28(36)37)24(17)21-4-2-11-34-26(21)20-8-6-16(30)14-23(20)32/h1-14H,(H,36,37) |
| InChIKey | BFEKPSNDNQELLE-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 501.44 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,4-bis[2-(2,4-difluorophenyl)-3-pyridinyl]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis[2-(2,4-difluorophenyl)-3-pyridinyl]pyridine-2-carboxylic acid?
The IUPAC name of 3,4-bis[2-(2,4-difluorophenyl)-3-pyridinyl]pyridine-2-carboxylic acid (CID 90703679) is 3,4-bis[2-(2,4-difluorophenyl)-3-pyridinyl]pyridine-2-carboxylic acid.
What is the SMILES notation for 3,4-bis[2-(2,4-difluorophenyl)-3-pyridinyl]pyridine-2-carboxylic acid?
The canonical SMILES for 3,4-bis[2-(2,4-difluorophenyl)-3-pyridinyl]pyridine-2-carboxylic acid is O=C(O)c1nccc(-c2cccnc2-c2ccc(F)cc2F)c1-c1cccnc1-c1ccc(F)cc1F.
What is the InChIKey of 3,4-bis[2-(2,4-difluorophenyl)-3-pyridinyl]pyridine-2-carboxylic acid?
The InChIKey is BFEKPSNDNQELLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H15F4N3O2/c29-15-5-7-19(22(31)13-15)25-18(3-1-10-33-25)17-9-12-35-27(28(36)37)24(17)21-4-2-11-34-26(21)20-8-6-16(30)14-23(20)32/h1-14H,(H,36,37).
What are the key properties of 3,4-bis[2-(2,4-difluorophenyl)-3-pyridinyl]pyridine-2-carboxylic acid?
3,4-bis[2-(2,4-difluorophenyl)-3-pyridinyl]pyridine-2-carboxylic acid has a molecular weight of 501.44 g/mol, XLogP of 6.79, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis[2-(2,4-difluorophenyl)-3-pyridinyl]pyridine-2-carboxylic acid is sourced from PubChem (CID 90703679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).