C21H26N4O5 — CID 90704108
N-(2,5-dihydroxy-1-prop-2-enylpyrrol-3-yl)-N-[[(2,5-dihydroxy-1-prop-2-enylpyrrol-3-yl)-prop-2-enylamino]methyl]prop-2-enamide (PubChem CID 90704108) has the molecular formula C21H26N4O5 and a molecular weight of 414.46 g/mol. Its IUPAC name is N-(2,5-dihydroxy-1-prop-2-enylpyrrol-3-yl)-N-[[(2,5-dihydroxy-1-prop-2-enylpyrrol-3-yl)-prop-2-enylamino]methyl]prop-2-enamide.
| Compound Name | N-(2,5-dihydroxy-1-prop-2-enylpyrrol-3-yl)-N-[[(2,5-dihydroxy-1-prop-2-enylpyrrol-3-yl)-prop-2-enylamino]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 90704108 |
| Molecular Formula | C21H26N4O5 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | N-(2,5-dihydroxy-1-prop-2-enylpyrrol-3-yl)-N-[[(2,5-dihydroxy-1-prop-2-enylpyrrol-3-yl)-prop-2-enylamino]methyl]prop-2-enamide |
| SMILES | C=CCN(CN(C(=O)C=C)c1cc(O)n(CC=C)c1O)c1cc(O)n(CC=C)c1O |
| InChI | InChI=1S/C21H26N4O5/c1-5-9-22(15-12-18(27)23(10-6-2)20(15)29)14-25(17(26)8-4)16-13-19(28)24(11-7-3)21(16)30/h5-8,12-13,27-30H,1-4,9-11,14H2 |
| InChIKey | RQZWFDSRPMATSC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 114.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|