C24H36F6O6 — CID 90705097
4-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 1-O-[5-(2-methylpropyl)-2-oxooxolan-3-yl] 2-tert-butyl-2-(2,2-dimethylpropyl)butanedioate (PubChem CID 90705097) has the molecular formula C24H36F6O6 and a molecular weight of 534.53 g/mol. Its IUPAC name is 4-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 1-O-[5-(2-methylpropyl)-2-oxooxolan-3-yl] 2-tert-butyl-2-(2,2-dimethylpropyl)butanedioate.
| Compound Name | 4-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 1-O-[5-(2-methylpropyl)-2-oxooxolan-3-yl] 2-tert-butyl-2-(2,2-dimethylpropyl)butanedioate |
|---|---|
| PubChem CID | 90705097 |
| Molecular Formula | C24H36F6O6 |
| Molecular Weight | 534.53 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | 4-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 1-O-[5-(2-methylpropyl)-2-oxooxolan-3-yl] 2-tert-butyl-2-(2,2-dimethylpropyl)butanedioate |
| SMILES | CC(C)CC1CC(OC(=O)C(CC(=O)OC(C(F)(F)F)C(F)(F)F)(CC(C)(C)C)C(C)(C)C)C(=O)O1 |
| InChI | InChI=1S/C24H36F6O6/c1-13(2)9-14-10-15(17(32)34-14)35-19(33)22(21(6,7)8,12-20(3,4)5)11-16(31)36-18(23(25,26)27)24(28,29)30/h13-15,18H,9-12H2,1-8H3 |
| InChIKey | SCKDYZGWWRNHSC-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.53 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|