C12H14F3N — CID 90705158
N,3-dimethyl-4-methylidene-6-(trifluoromethyl)octa-2,5,7-trien-1-imine (PubChem CID 90705158) has the molecular formula C12H14F3N and a molecular weight of 229.24 g/mol. Its IUPAC name is N,3-dimethyl-4-methylidene-6-(trifluoromethyl)octa-2,5,7-trien-1-imine.
| Compound Name | N,3-dimethyl-4-methylidene-6-(trifluoromethyl)octa-2,5,7-trien-1-imine |
|---|---|
| PubChem CID | 90705158 |
| Molecular Formula | C12H14F3N |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | N,3-dimethyl-4-methylidene-6-(trifluoromethyl)octa-2,5,7-trien-1-imine |
| SMILES | C=CC(=CC(=C)C(C)=C/C=N/C)C(F)(F)F |
| InChI | InChI=1S/C12H14F3N/c1-5-11(12(13,14)15)8-10(3)9(2)6-7-16-4/h5-8H,1,3H2,2,4H3/b9-6?,11-8?,16-7+ |
| InChIKey | WIHZVPDXSMDHLX-BFLOHFPASA-N |
| XLogP | 3.86 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|