C16H14ClFN4O2 — CID 90705199
1-[2-chloro-4-[[2-(2-fluoroethyl)-3-hydroxyisoindol-4-yl]amino]pyrimidin-5-yl]ethanone (PubChem CID 90705199) has the molecular formula C16H14ClFN4O2 and a molecular weight of 348.77 g/mol. Its IUPAC name is 1-[2-chloro-4-[[2-(2-fluoroethyl)-3-hydroxyisoindol-4-yl]amino]pyrimidin-5-yl]ethanone.
| Compound Name | 1-[2-chloro-4-[[2-(2-fluoroethyl)-3-hydroxyisoindol-4-yl]amino]pyrimidin-5-yl]ethanone |
|---|---|
| PubChem CID | 90705199 |
| Molecular Formula | C16H14ClFN4O2 |
| Molecular Weight | 348.77 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 1-[2-chloro-4-[[2-(2-fluoroethyl)-3-hydroxyisoindol-4-yl]amino]pyrimidin-5-yl]ethanone |
| SMILES | CC(=O)c1cnc(Cl)nc1Nc1cccc2cn(CCF)c(O)c12 |
| InChI | InChI=1S/C16H14ClFN4O2/c1-9(23)11-7-19-16(17)21-14(11)20-12-4-2-3-10-8-22(6-5-18)15(24)13(10)12/h2-4,7-8,24H,5-6H2,1H3,(H,19,20,21) |
| InChIKey | UKQPRYLBVKWMQC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.77 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |