About 1-decyl-2-[1-(3,7-dimethylocta-2,6-dienyl)imidazol-2-yl]imidazole
1-decyl-2-[1-(3,7-dimethylocta-2,6-dienyl)imidazol-2-yl]imidazole (PubChem CID 90705757) has the molecular formula C26H42N4
and a molecular weight of 410.65 g/mol. Its IUPAC name is 1-decyl-2-[1-(3,7-dimethylocta-2,6-dienyl)imidazol-2-yl]imidazole.
Molecular Properties
| Compound Name | 1-decyl-2-[1-(3,7-dimethylocta-2,6-dienyl)imidazol-2-yl]imidazole |
| PubChem CID | 90705757 |
| Molecular Formula | C26H42N4 |
| Molecular Weight | 410.65 g/mol |
| Exact Mass | 410.34 |
| IUPAC Name | 1-decyl-2-[1-(3,7-dimethylocta-2,6-dienyl)imidazol-2-yl]imidazole |
| SMILES | CCCCCCCCCCn1ccnc1-c1nccn1CC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C26H42N4/c1-5-6-7-8-9-10-11-12-19-29-21-17-27-25(29)26-28-18-22-30(26)20-16-24(4)15-13-14-23(2)3/h14,16-18,21-22H,5-13,15,19-20H2,1-4H3 |
| InChIKey | MYTLCOKCLBWSOP-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.65 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-decyl-2-[1-(3,7-dimethylocta-2,6-dienyl)imidazol-2-yl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-decyl-2-[1-(3,7-dimethylocta-2,6-dienyl)imidazol-2-yl]imidazole?
The IUPAC name of 1-decyl-2-[1-(3,7-dimethylocta-2,6-dienyl)imidazol-2-yl]imidazole (CID 90705757) is 1-decyl-2-[1-(3,7-dimethylocta-2,6-dienyl)imidazol-2-yl]imidazole.
What is the SMILES notation for 1-decyl-2-[1-(3,7-dimethylocta-2,6-dienyl)imidazol-2-yl]imidazole?
The canonical SMILES for 1-decyl-2-[1-(3,7-dimethylocta-2,6-dienyl)imidazol-2-yl]imidazole is CCCCCCCCCCn1ccnc1-c1nccn1CC=C(C)CCC=C(C)C.
What is the InChIKey of 1-decyl-2-[1-(3,7-dimethylocta-2,6-dienyl)imidazol-2-yl]imidazole?
The InChIKey is MYTLCOKCLBWSOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H42N4/c1-5-6-7-8-9-10-11-12-19-29-21-17-27-25(29)26-28-18-22-30(26)20-16-24(4)15-13-14-23(2)3/h14,16-18,21-22H,5-13,15,19-20H2,1-4H3.
What are the key properties of 1-decyl-2-[1-(3,7-dimethylocta-2,6-dienyl)imidazol-2-yl]imidazole?
1-decyl-2-[1-(3,7-dimethylocta-2,6-dienyl)imidazol-2-yl]imidazole has a molecular weight of 410.65 g/mol, XLogP of 7.58, 15 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-decyl-2-[1-(3,7-dimethylocta-2,6-dienyl)imidazol-2-yl]imidazole is sourced from PubChem (CID 90705757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).