C11H14F3N — CID 90705914
7,7,7-trifluoro-N,3,6-trimethyl-4-methylidenehepta-2,5-dien-1-imine (PubChem CID 90705914) has the molecular formula C11H14F3N and a molecular weight of 217.23 g/mol. Its IUPAC name is 7,7,7-trifluoro-N,3,6-trimethyl-4-methylidenehepta-2,5-dien-1-imine.
| Compound Name | 7,7,7-trifluoro-N,3,6-trimethyl-4-methylidenehepta-2,5-dien-1-imine |
|---|---|
| PubChem CID | 90705914 |
| Molecular Formula | C11H14F3N |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 7,7,7-trifluoro-N,3,6-trimethyl-4-methylidenehepta-2,5-dien-1-imine |
| SMILES | C=C(C=C(C)C(F)(F)F)C(C)=C/C=N/C |
| InChI | InChI=1S/C11H14F3N/c1-8(5-6-15-4)9(2)7-10(3)11(12,13)14/h5-7H,2H2,1,3-4H3/b8-5?,10-7?,15-6+ |
| InChIKey | FMLYOHRTTXCHDP-ZYDRNXNZSA-N |
| XLogP | 3.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|