C21H24N4O10S — CID 90706090
2-(2-amino-5-hydroxy-1,3-thiazol-4-yl)-N-[4-[1,1-dihydroxy-2-(2-phenylethylamino)ethyl]-2,3,5,6-tetrahydroxyphenyl]-2,2-dihydroxyacetamide (PubChem CID 90706090) has the molecular formula C21H24N4O10S and a molecular weight of 524.51 g/mol. Its IUPAC name is 2-(2-amino-5-hydroxy-1,3-thiazol-4-yl)-N-[4-[1,1-dihydroxy-2-(2-phenylethylamino)ethyl]-2,3,5,6-tetrahydroxyphenyl]-2,2-dihydroxyacetamide.
| Compound Name | 2-(2-amino-5-hydroxy-1,3-thiazol-4-yl)-N-[4-[1,1-dihydroxy-2-(2-phenylethylamino)ethyl]-2,3,5,6-tetrahydroxyphenyl]-2,2-dihydroxyacetamide |
|---|---|
| PubChem CID | 90706090 |
| Molecular Formula | C21H24N4O10S |
| Molecular Weight | 524.51 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | 2-(2-amino-5-hydroxy-1,3-thiazol-4-yl)-N-[4-[1,1-dihydroxy-2-(2-phenylethylamino)ethyl]-2,3,5,6-tetrahydroxyphenyl]-2,2-dihydroxyacetamide |
| SMILES | Nc1nc(C(O)(O)C(=O)Nc2c(O)c(O)c(C(O)(O)CNCCc3ccccc3)c(O)c2O)c(O)s1 |
| InChI | InChI=1S/C21H24N4O10S/c22-19-25-16(17(30)36-19)21(34,35)18(31)24-11-14(28)12(26)10(13(27)15(11)29)20(32,33)8-23-7-6-9-4-2-1-3-5-9/h1-5,23,26-30,32-35H,6-8H2,(H2,22,25)(H,24,31) |
| InChIKey | QCHNREBWKMOWPU-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 262.11 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.51 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|