C28H25N5O5S — CID 90706345
1,3-thiazol-5-ylmethyl N-[(2S,3R)-4-[[2-(ethynylamino)-1,3-benzoxazole-6-carbonyl]-prop-2-ynylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 90706345) has the molecular formula C28H25N5O5S and a molecular weight of 543.61 g/mol. Its IUPAC name is 1,3-thiazol-5-ylmethyl N-[(2S,3R)-4-[[2-(ethynylamino)-1,3-benzoxazole-6-carbonyl]-prop-2-ynylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | 1,3-thiazol-5-ylmethyl N-[(2S,3R)-4-[[2-(ethynylamino)-1,3-benzoxazole-6-carbonyl]-prop-2-ynylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 90706345 |
| Molecular Formula | C28H25N5O5S |
| Molecular Weight | 543.61 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | 1,3-thiazol-5-ylmethyl N-[(2S,3R)-4-[[2-(ethynylamino)-1,3-benzoxazole-6-carbonyl]-prop-2-ynylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | C#CCN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)OCc1cncs1)C(=O)c1ccc2nc(NC#C)oc2c1 |
| InChI | InChI=1S/C28H25N5O5S/c1-3-12-33(26(35)20-10-11-22-25(14-20)38-27(31-22)30-4-2)16-24(34)23(13-19-8-6-5-7-9-19)32-28(36)37-17-21-15-29-18-39-21/h1-2,5-11,14-15,18,23-24,34H,12-13,16-17H2,(H,30,31)(H,32,36)/t23-,24+/m0/s1 |
| InChIKey | XXWLBPIAUPAFQU-BJKOFHAPSA-N |
| XLogP | 3.26 |
| TPSA | 129.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.61 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|