C32H29F3N2O5 — CID 90706379
N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-[3-(oxan-4-yloxy)phenyl]-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide (PubChem CID 90706379) has the molecular formula C32H29F3N2O5 and a molecular weight of 578.59 g/mol. Its IUPAC name is N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-[3-(oxan-4-yloxy)phenyl]-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide.
| Compound Name | N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-[3-(oxan-4-yloxy)phenyl]-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 90706379 |
| Molecular Formula | C32H29F3N2O5 |
| Molecular Weight | 578.59 g/mol |
| Exact Mass | 578.20 |
| IUPAC Name | N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-[3-(oxan-4-yloxy)phenyl]-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
| SMILES | O=C(C=CC=C(c1ccc(C(F)(F)F)cc1)c1cccc(OC2CCOCC2)c1)Nc1cccc2c1CC(O)C(=O)N2 |
| InChI | InChI=1S/C32H29F3N2O5/c33-32(34,35)22-12-10-20(11-13-22)25(21-4-1-5-24(18-21)42-23-14-16-41-17-15-23)6-2-9-30(39)36-27-7-3-8-28-26(27)19-29(38)31(40)37-28/h1-13,18,23,29,38H,14-17,19H2,(H,36,39)(H,37,40) |
| InChIKey | LUSVWLNJPZCRQS-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.59 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|