C31H42F3N3O — CID 90706592
(4aR,11R,11aS)-11-methyl-2-[2-[4-(3-pyrrolidin-1-ylprop-1-enyl)oxan-4-yl]ethyl]-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazole (PubChem CID 90706592) has the molecular formula C31H42F3N3O and a molecular weight of 529.69 g/mol. Its IUPAC name is (4aR,11R,11aS)-11-methyl-2-[2-[4-(3-pyrrolidin-1-ylprop-1-enyl)oxan-4-yl]ethyl]-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazole.
| Compound Name | (4aR,11R,11aS)-11-methyl-2-[2-[4-(3-pyrrolidin-1-ylprop-1-enyl)oxan-4-yl]ethyl]-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazole |
|---|---|
| PubChem CID | 90706592 |
| Molecular Formula | C31H42F3N3O |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.33 |
| IUPAC Name | (4aR,11R,11aS)-11-methyl-2-[2-[4-(3-pyrrolidin-1-ylprop-1-enyl)oxan-4-yl]ethyl]-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazole |
| SMILES | C[C@H]1c2c([nH]c3ccc(C(F)(F)F)cc23)C[C@H]2CCN(CCC3(C=CCN4CCCC4)CCOCC3)C[C@@H]21 |
| InChI | InChI=1S/C31H42F3N3O/c1-22-26-21-37(16-9-30(10-17-38-18-11-30)8-4-14-36-12-2-3-13-36)15-7-23(26)19-28-29(22)25-20-24(31(32,33)34)5-6-27(25)35-28/h4-6,8,20,22-23,26,35H,2-3,7,9-19,21H2,1H3/t22-,23-,26-/m1/s1 |
| InChIKey | ALEACYBDGXIZRE-JQYIIUTOSA-N |
| XLogP | 6.62 |
| TPSA | 31.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|