About (5-formylthiophen-2-yl) propanoate
(5-formylthiophen-2-yl) propanoate (PubChem CID 90706669) has the molecular formula C8H8O3S
and a molecular weight of 184.22 g/mol. Its IUPAC name is (5-formylthiophen-2-yl) propanoate.
Molecular Properties
| Compound Name | (5-formylthiophen-2-yl) propanoate |
| PubChem CID | 90706669 |
| Molecular Formula | C8H8O3S |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.02 |
| IUPAC Name | (5-formylthiophen-2-yl) propanoate |
| SMILES | CCC(=O)Oc1ccc(C=O)s1 |
| InChI | InChI=1S/C8H8O3S/c1-2-7(10)11-8-4-3-6(5-9)12-8/h3-5H,2H2,1H3 |
| InChIKey | RKMVRZCIFQFYFT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (5-formylthiophen-2-yl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-formylthiophen-2-yl) propanoate?
The IUPAC name of (5-formylthiophen-2-yl) propanoate (CID 90706669) is (5-formylthiophen-2-yl) propanoate.
What is the SMILES notation for (5-formylthiophen-2-yl) propanoate?
The canonical SMILES for (5-formylthiophen-2-yl) propanoate is CCC(=O)Oc1ccc(C=O)s1.
What is the InChIKey of (5-formylthiophen-2-yl) propanoate?
The InChIKey is RKMVRZCIFQFYFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3S/c1-2-7(10)11-8-4-3-6(5-9)12-8/h3-5H,2H2,1H3.
What are the key properties of (5-formylthiophen-2-yl) propanoate?
(5-formylthiophen-2-yl) propanoate has a molecular weight of 184.22 g/mol, XLogP of 1.88, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-formylthiophen-2-yl) propanoate is sourced from PubChem (CID 90706669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).