About CID 90707190
CID 90707190 (PubChem CID 90707190) has the molecular formula C14H27BN3O
and a molecular weight of 264.20 g/mol.
Molecular Properties
| Compound Name | CID 90707190 |
| PubChem CID | 90707190 |
| Molecular Formula | C14H27BN3O |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | — |
| SMILES | CC.CN1CCN(C2CC[B]CC2CN=C=O)CC1 |
| InChI | InChI=1S/C12H21BN3O.C2H6/c1-15-4-6-16(7-5-15)12-2-3-13-8-11(12)9-14-10-17;1-2/h11-12H,2-9H2,1H3;1-2H3 |
| InChIKey | HPVYAQRXILYPDY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze CID 90707190 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90707190?
The IUPAC name of CID 90707190 (CID 90707190) is not available.
What is the SMILES notation for CID 90707190?
The canonical SMILES for CID 90707190 is CC.CN1CCN(C2CC[B]CC2CN=C=O)CC1.
What is the InChIKey of CID 90707190?
The InChIKey is HPVYAQRXILYPDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21BN3O.C2H6/c1-15-4-6-16(7-5-15)12-2-3-13-8-11(12)9-14-10-17;1-2/h11-12H,2-9H2,1H3;1-2H3.
What are the key properties of CID 90707190?
CID 90707190 has a molecular weight of 264.20 g/mol, XLogP of 1.53, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90707190 is sourced from PubChem (CID 90707190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).