C16H13F3N2O — CID 90707485
1-(5,14-diazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4(9),5,7,10-pentaen-10-yl)-2,2,2-trifluoroethanone (PubChem CID 90707485) has the molecular formula C16H13F3N2O and a molecular weight of 306.29 g/mol. Its IUPAC name is 1-(5,14-diazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4(9),5,7,10-pentaen-10-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(5,14-diazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4(9),5,7,10-pentaen-10-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 90707485 |
| Molecular Formula | C16H13F3N2O |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 1-(5,14-diazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4(9),5,7,10-pentaen-10-yl)-2,2,2-trifluoroethanone |
| SMILES | O=C(c1c2c(cc3ncccc13)C1CNCC2C1)C(F)(F)F |
| InChI | InChI=1S/C16H13F3N2O/c17-16(18,19)15(22)14-10-2-1-3-21-12(10)5-11-8-4-9(13(11)14)7-20-6-8/h1-3,5,8-9,20H,4,6-7H2 |
| InChIKey | PXMKPRCKKQYYMY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |