C14H16FNS — CID 90707689
2-butan-2-yl-5-(3-fluorophenyl)-4-methyl-1,3-thiazole (PubChem CID 90707689) has the molecular formula C14H16FNS and a molecular weight of 249.35 g/mol. Its IUPAC name is 2-butan-2-yl-5-(3-fluorophenyl)-4-methyl-1,3-thiazole.
| Compound Name | 2-butan-2-yl-5-(3-fluorophenyl)-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 90707689 |
| Molecular Formula | C14H16FNS |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 2-butan-2-yl-5-(3-fluorophenyl)-4-methyl-1,3-thiazole |
| SMILES | CCC(C)c1nc(C)c(-c2cccc(F)c2)s1 |
| InChI | InChI=1S/C14H16FNS/c1-4-9(2)14-16-10(3)13(17-14)11-6-5-7-12(15)8-11/h5-9H,4H2,1-3H3 |
| InChIKey | QTBIBZJNOCRTDU-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |