C14H24NO6PS — CID 90707760
3-[[(2R,3R,5R)-2-ethyl-5-tritiooxolan-3-yl]oxy-[[(2R,3R,5S)-3-hydroxy-5-tritiooxolan-2-yl]methoxy]phosphinothioyl]oxypropanenitrile (PubChem CID 90707760) has the molecular formula C14H24NO6PS and a molecular weight of 369.40 g/mol. Its IUPAC name is 3-[[(2R,3R,5R)-2-ethyl-5-tritiooxolan-3-yl]oxy-[[(2R,3R,5S)-3-hydroxy-5-tritiooxolan-2-yl]methoxy]phosphinothioyl]oxypropanenitrile.
| Compound Name | 3-[[(2R,3R,5R)-2-ethyl-5-tritiooxolan-3-yl]oxy-[[(2R,3R,5S)-3-hydroxy-5-tritiooxolan-2-yl]methoxy]phosphinothioyl]oxypropanenitrile |
|---|---|
| PubChem CID | 90707760 |
| Molecular Formula | C14H24NO6PS |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 3-[[(2R,3R,5R)-2-ethyl-5-tritiooxolan-3-yl]oxy-[[(2R,3R,5S)-3-hydroxy-5-tritiooxolan-2-yl]methoxy]phosphinothioyl]oxypropanenitrile |
| SMILES | [3H][C@@H]1C[C@@H](OP(=S)(OCCC#N)OC[C@H]2O[C@@H]([3H])C[C@H]2O)[C@@H](CC)O1 |
| InChI | InChI=1S/C14H24NO6PS/c1-2-12-13(5-9-17-12)21-22(23,19-7-3-6-15)20-10-14-11(16)4-8-18-14/h11-14,16H,2-5,7-10H2,1H3/t11-,12-,13-,14-,22?/m1/s1/i8T,9T/t8-,9+,11+,12+,13+,14+,22?/m0 |
| InChIKey | ABJKFESIAXGZIU-IPLPJSHESA-N |
| XLogP | 1.89 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|