About N-[2-(4-methoxy-1,3-oxazol-2-yl)phenyl]-3-(trifluoromethyl)benzenesulfonamide
N-[2-(4-methoxy-1,3-oxazol-2-yl)phenyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 90707974) has the molecular formula C17H13F3N2O4S
and a molecular weight of 398.36 g/mol. Its IUPAC name is N-[2-(4-methoxy-1,3-oxazol-2-yl)phenyl]-3-(trifluoromethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-[2-(4-methoxy-1,3-oxazol-2-yl)phenyl]-3-(trifluoromethyl)benzenesulfonamide |
| PubChem CID | 90707974 |
| Molecular Formula | C17H13F3N2O4S |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | N-[2-(4-methoxy-1,3-oxazol-2-yl)phenyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | COc1coc(-c2ccccc2NS(=O)(=O)c2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C17H13F3N2O4S/c1-25-15-10-26-16(21-15)13-7-2-3-8-14(13)22-27(23,24)12-6-4-5-11(9-12)17(18,19)20/h2-10,22H,1H3 |
| InChIKey | HVLLOSJAEZBILT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(4-methoxy-1,3-oxazol-2-yl)phenyl]-3-(trifluoromethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-methoxy-1,3-oxazol-2-yl)phenyl]-3-(trifluoromethyl)benzenesulfonamide?
The IUPAC name of N-[2-(4-methoxy-1,3-oxazol-2-yl)phenyl]-3-(trifluoromethyl)benzenesulfonamide (CID 90707974) is N-[2-(4-methoxy-1,3-oxazol-2-yl)phenyl]-3-(trifluoromethyl)benzenesulfonamide.
What is the SMILES notation for N-[2-(4-methoxy-1,3-oxazol-2-yl)phenyl]-3-(trifluoromethyl)benzenesulfonamide?
The canonical SMILES for N-[2-(4-methoxy-1,3-oxazol-2-yl)phenyl]-3-(trifluoromethyl)benzenesulfonamide is COc1coc(-c2ccccc2NS(=O)(=O)c2cccc(C(F)(F)F)c2)n1.
What is the InChIKey of N-[2-(4-methoxy-1,3-oxazol-2-yl)phenyl]-3-(trifluoromethyl)benzenesulfonamide?
The InChIKey is HVLLOSJAEZBILT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13F3N2O4S/c1-25-15-10-26-16(21-15)13-7-2-3-8-14(13)22-27(23,24)12-6-4-5-11(9-12)17(18,19)20/h2-10,22H,1H3.
What are the key properties of N-[2-(4-methoxy-1,3-oxazol-2-yl)phenyl]-3-(trifluoromethyl)benzenesulfonamide?
N-[2-(4-methoxy-1,3-oxazol-2-yl)phenyl]-3-(trifluoromethyl)benzenesulfonamide has a molecular weight of 398.36 g/mol, XLogP of 4.17, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-methoxy-1,3-oxazol-2-yl)phenyl]-3-(trifluoromethyl)benzenesulfonamide is sourced from PubChem (CID 90707974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).