About (R)-N-[(S)-(2-amino-1,3-thiazol-5-yl)-phenylmethyl]-2-methylpropane-2-sulfinamide;ethane
(R)-N-[(S)-(2-amino-1,3-thiazol-5-yl)-phenylmethyl]-2-methylpropane-2-sulfinamide;ethane (PubChem CID 90708102) has the molecular formula C16H25N3OS2
and a molecular weight of 339.53 g/mol. Its IUPAC name is (R)-N-[(S)-(2-amino-1,3-thiazol-5-yl)-phenylmethyl]-2-methylpropane-2-sulfinamide;ethane.
Molecular Properties
| Compound Name | (R)-N-[(S)-(2-amino-1,3-thiazol-5-yl)-phenylmethyl]-2-methylpropane-2-sulfinamide;ethane |
| PubChem CID | 90708102 |
| Molecular Formula | C16H25N3OS2 |
| Molecular Weight | 339.53 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | (R)-N-[(S)-(2-amino-1,3-thiazol-5-yl)-phenylmethyl]-2-methylpropane-2-sulfinamide;ethane |
| SMILES | CC.CC(C)(C)[S@@](=O)N[C@@H](c1ccccc1)c1cnc(N)s1 |
| InChI | InChI=1S/C14H19N3OS2.C2H6/c1-14(2,3)20(18)17-12(10-7-5-4-6-8-10)11-9-16-13(15)19-11;1-2/h4-9,12,17H,1-3H3,(H2,15,16);1-2H3/t12-,20+;/m0./s1 |
| InChIKey | KLGRFDYHAKZWPU-XVHUJMMASA-N |
| XLogP | 3.89 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (R)-N-[(S)-(2-amino-1,3-thiazol-5-yl)-phenylmethyl]-2-methylpropane-2-sulfinamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (R)-N-[(S)-(2-amino-1,3-thiazol-5-yl)-phenylmethyl]-2-methylpropane-2-sulfinamide;ethane?
The IUPAC name of (R)-N-[(S)-(2-amino-1,3-thiazol-5-yl)-phenylmethyl]-2-methylpropane-2-sulfinamide;ethane (CID 90708102) is (R)-N-[(S)-(2-amino-1,3-thiazol-5-yl)-phenylmethyl]-2-methylpropane-2-sulfinamide;ethane.
What is the SMILES notation for (R)-N-[(S)-(2-amino-1,3-thiazol-5-yl)-phenylmethyl]-2-methylpropane-2-sulfinamide;ethane?
The canonical SMILES for (R)-N-[(S)-(2-amino-1,3-thiazol-5-yl)-phenylmethyl]-2-methylpropane-2-sulfinamide;ethane is CC.CC(C)(C)[S@@](=O)N[C@@H](c1ccccc1)c1cnc(N)s1.
What is the InChIKey of (R)-N-[(S)-(2-amino-1,3-thiazol-5-yl)-phenylmethyl]-2-methylpropane-2-sulfinamide;ethane?
The InChIKey is KLGRFDYHAKZWPU-XVHUJMMASA-N. The full InChI is InChI=1S/C14H19N3OS2.C2H6/c1-14(2,3)20(18)17-12(10-7-5-4-6-8-10)11-9-16-13(15)19-11;1-2/h4-9,12,17H,1-3H3,(H2,15,16);1-2H3/t12-,20+;/m0./s1.
What are the key properties of (R)-N-[(S)-(2-amino-1,3-thiazol-5-yl)-phenylmethyl]-2-methylpropane-2-sulfinamide;ethane?
(R)-N-[(S)-(2-amino-1,3-thiazol-5-yl)-phenylmethyl]-2-methylpropane-2-sulfinamide;ethane has a molecular weight of 339.53 g/mol, XLogP of 3.89, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (R)-N-[(S)-(2-amino-1,3-thiazol-5-yl)-phenylmethyl]-2-methylpropane-2-sulfinamide;ethane is sourced from PubChem (CID 90708102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).