C16H18N4O4S — CID 9070811
3-(4-benzylsulfonylpiperazine-1-carbonyl)-1H-pyridazin-6-one (PubChem CID 9070811) has the molecular formula C16H18N4O4S and a molecular weight of 362.41 g/mol. Its IUPAC name is 3-(4-benzylsulfonylpiperazine-1-carbonyl)-1H-pyridazin-6-one.
| Compound Name | 3-(4-benzylsulfonylpiperazine-1-carbonyl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 9070811 |
| Molecular Formula | C16H18N4O4S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 3-(4-benzylsulfonylpiperazine-1-carbonyl)-1H-pyridazin-6-one |
| SMILES | O=C(c1ccc(=O)[nH]n1)N1CCN(S(=O)(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C16H18N4O4S/c21-15-7-6-14(17-18-15)16(22)19-8-10-20(11-9-19)25(23,24)12-13-4-2-1-3-5-13/h1-7H,8-12H2,(H,18,21) |
| InChIKey | MQSYEPCIXACNHY-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 103.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |