About 2-cyclopentyl-2-(3,4-dichlorophenyl)-1-[(2R)-1-piperidin-4-ylpiperidin-2-yl]ethanone
2-cyclopentyl-2-(3,4-dichlorophenyl)-1-[(2R)-1-piperidin-4-ylpiperidin-2-yl]ethanone (PubChem CID 90708161) has the molecular formula C23H32Cl2N2O
and a molecular weight of 423.43 g/mol. Its IUPAC name is 2-cyclopentyl-2-(3,4-dichlorophenyl)-1-[(2R)-1-piperidin-4-ylpiperidin-2-yl]ethanone.
Molecular Properties
| Compound Name | 2-cyclopentyl-2-(3,4-dichlorophenyl)-1-[(2R)-1-piperidin-4-ylpiperidin-2-yl]ethanone |
| PubChem CID | 90708161 |
| Molecular Formula | C23H32Cl2N2O |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 2-cyclopentyl-2-(3,4-dichlorophenyl)-1-[(2R)-1-piperidin-4-ylpiperidin-2-yl]ethanone |
| SMILES | O=C(C(c1ccc(Cl)c(Cl)c1)C1CCCC1)[C@H]1CCCCN1C1CCNCC1 |
| InChI | InChI=1S/C23H32Cl2N2O/c24-19-9-8-17(15-20(19)25)22(16-5-1-2-6-16)23(28)21-7-3-4-14-27(21)18-10-12-26-13-11-18/h8-9,15-16,18,21-22,26H,1-7,10-14H2/t21-,22?/m1/s1 |
| InChIKey | DOODSUNMACRFJY-ZMFCMNQTSA-N |
| XLogP | 5.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopentyl-2-(3,4-dichlorophenyl)-1-[(2R)-1-piperidin-4-ylpiperidin-2-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentyl-2-(3,4-dichlorophenyl)-1-[(2R)-1-piperidin-4-ylpiperidin-2-yl]ethanone?
The IUPAC name of 2-cyclopentyl-2-(3,4-dichlorophenyl)-1-[(2R)-1-piperidin-4-ylpiperidin-2-yl]ethanone (CID 90708161) is 2-cyclopentyl-2-(3,4-dichlorophenyl)-1-[(2R)-1-piperidin-4-ylpiperidin-2-yl]ethanone.
What is the SMILES notation for 2-cyclopentyl-2-(3,4-dichlorophenyl)-1-[(2R)-1-piperidin-4-ylpiperidin-2-yl]ethanone?
The canonical SMILES for 2-cyclopentyl-2-(3,4-dichlorophenyl)-1-[(2R)-1-piperidin-4-ylpiperidin-2-yl]ethanone is O=C(C(c1ccc(Cl)c(Cl)c1)C1CCCC1)[C@H]1CCCCN1C1CCNCC1.
What is the InChIKey of 2-cyclopentyl-2-(3,4-dichlorophenyl)-1-[(2R)-1-piperidin-4-ylpiperidin-2-yl]ethanone?
The InChIKey is DOODSUNMACRFJY-ZMFCMNQTSA-N. The full InChI is InChI=1S/C23H32Cl2N2O/c24-19-9-8-17(15-20(19)25)22(16-5-1-2-6-16)23(28)21-7-3-4-14-27(21)18-10-12-26-13-11-18/h8-9,15-16,18,21-22,26H,1-7,10-14H2/t21-,22?/m1/s1.
What are the key properties of 2-cyclopentyl-2-(3,4-dichlorophenyl)-1-[(2R)-1-piperidin-4-ylpiperidin-2-yl]ethanone?
2-cyclopentyl-2-(3,4-dichlorophenyl)-1-[(2R)-1-piperidin-4-ylpiperidin-2-yl]ethanone has a molecular weight of 423.43 g/mol, XLogP of 5.44, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-2-(3,4-dichlorophenyl)-1-[(2R)-1-piperidin-4-ylpiperidin-2-yl]ethanone is sourced from PubChem (CID 90708161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).