C15H13N5O — CID 90708322
5-[2-amino-4-(4-methylphenyl)pyrimidin-5-yl]-1H-pyridazin-6-one (PubChem CID 90708322) has the molecular formula C15H13N5O and a molecular weight of 279.30 g/mol. Its IUPAC name is 5-[2-amino-4-(4-methylphenyl)pyrimidin-5-yl]-1H-pyridazin-6-one.
| Compound Name | 5-[2-amino-4-(4-methylphenyl)pyrimidin-5-yl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 90708322 |
| Molecular Formula | C15H13N5O |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 5-[2-amino-4-(4-methylphenyl)pyrimidin-5-yl]-1H-pyridazin-6-one |
| SMILES | Cc1ccc(-c2nc(N)ncc2-c2ccn[nH]c2=O)cc1 |
| InChI | InChI=1S/C15H13N5O/c1-9-2-4-10(5-3-9)13-12(8-17-15(16)19-13)11-6-7-18-20-14(11)21/h2-8H,1H3,(H,20,21)(H2,16,17,19) |
| InChIKey | SJBLTZNLCSPRID-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |