About deuteriomethane;ethane;1-(2-ethylsulfonylethyl)piperidine-4-carboxylic acid
deuteriomethane;ethane;1-(2-ethylsulfonylethyl)piperidine-4-carboxylic acid (PubChem CID 90708596) has the molecular formula C13H29NO4S
and a molecular weight of 296.45 g/mol. Its IUPAC name is deuteriomethane;ethane;1-(2-ethylsulfonylethyl)piperidine-4-carboxylic acid.
Molecular Properties
| Compound Name | deuteriomethane;ethane;1-(2-ethylsulfonylethyl)piperidine-4-carboxylic acid |
| PubChem CID | 90708596 |
| Molecular Formula | C13H29NO4S |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | deuteriomethane;ethane;1-(2-ethylsulfonylethyl)piperidine-4-carboxylic acid |
| SMILES | CC.CCS(=O)(=O)CCN1CCC(C(=O)O)CC1.[2H]C |
| InChI | InChI=1S/C10H19NO4S.C2H6.CH4/c1-2-16(14,15)8-7-11-5-3-9(4-6-11)10(12)13;1-2;/h9H,2-8H2,1H3,(H,12,13);1-2H3;1H4/i;;1D |
| InChIKey | KFQDECBRJUCSEG-PRQZKWGPSA-N |
| XLogP | 1.88 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze deuteriomethane;ethane;1-(2-ethylsulfonylethyl)piperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deuteriomethane;ethane;1-(2-ethylsulfonylethyl)piperidine-4-carboxylic acid?
The IUPAC name of deuteriomethane;ethane;1-(2-ethylsulfonylethyl)piperidine-4-carboxylic acid (CID 90708596) is deuteriomethane;ethane;1-(2-ethylsulfonylethyl)piperidine-4-carboxylic acid.
What is the SMILES notation for deuteriomethane;ethane;1-(2-ethylsulfonylethyl)piperidine-4-carboxylic acid?
The canonical SMILES for deuteriomethane;ethane;1-(2-ethylsulfonylethyl)piperidine-4-carboxylic acid is CC.CCS(=O)(=O)CCN1CCC(C(=O)O)CC1.[2H]C.
What is the InChIKey of deuteriomethane;ethane;1-(2-ethylsulfonylethyl)piperidine-4-carboxylic acid?
The InChIKey is KFQDECBRJUCSEG-PRQZKWGPSA-N. The full InChI is InChI=1S/C10H19NO4S.C2H6.CH4/c1-2-16(14,15)8-7-11-5-3-9(4-6-11)10(12)13;1-2;/h9H,2-8H2,1H3,(H,12,13);1-2H3;1H4/i;;1D.
What are the key properties of deuteriomethane;ethane;1-(2-ethylsulfonylethyl)piperidine-4-carboxylic acid?
deuteriomethane;ethane;1-(2-ethylsulfonylethyl)piperidine-4-carboxylic acid has a molecular weight of 296.45 g/mol, XLogP of 1.88, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for deuteriomethane;ethane;1-(2-ethylsulfonylethyl)piperidine-4-carboxylic acid is sourced from PubChem (CID 90708596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).