C23H28N4O13S — CID 90708732
2-(2-amino-5-hydroxy-1,3-thiazol-4-yl)-2,2-dihydroxy-N-[2,3,5,6-tetrahydroxy-4-[2-[[2-methoxy-2-(2,3,4,5-tetrahydroxy-6-methylphenyl)ethyl]amino]ethyl]phenyl]acetamide (PubChem CID 90708732) has the molecular formula C23H28N4O13S and a molecular weight of 600.56 g/mol. Its IUPAC name is 2-(2-amino-5-hydroxy-1,3-thiazol-4-yl)-2,2-dihydroxy-N-[2,3,5,6-tetrahydroxy-4-[2-[[2-methoxy-2-(2,3,4,5-tetrahydroxy-6-methylphenyl)ethyl]amino]ethyl]phenyl]acetamide.
| Compound Name | 2-(2-amino-5-hydroxy-1,3-thiazol-4-yl)-2,2-dihydroxy-N-[2,3,5,6-tetrahydroxy-4-[2-[[2-methoxy-2-(2,3,4,5-tetrahydroxy-6-methylphenyl)ethyl]amino]ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 90708732 |
| Molecular Formula | C23H28N4O13S |
| Molecular Weight | 600.56 g/mol |
| Exact Mass | 600.14 |
| IUPAC Name | 2-(2-amino-5-hydroxy-1,3-thiazol-4-yl)-2,2-dihydroxy-N-[2,3,5,6-tetrahydroxy-4-[2-[[2-methoxy-2-(2,3,4,5-tetrahydroxy-6-methylphenyl)ethyl]amino]ethyl]phenyl]acetamide |
| SMILES | COC(CNCCc1c(O)c(O)c(NC(=O)C(O)(O)c2nc(N)sc2O)c(O)c1O)c1c(C)c(O)c(O)c(O)c1O |
| InChI | InChI=1S/C23H28N4O13S/c1-6-9(14(31)18(35)17(34)11(6)28)8(40-2)5-25-4-3-7-12(29)15(32)10(16(33)13(7)30)26-21(37)23(38,39)19-20(36)41-22(24)27-19/h8,25,28-36,38-39H,3-5H2,1-2H3,(H2,24,27)(H,26,37) |
| InChIKey | PMMKJRMQPJLYAR-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 311.80 Ų |
| H-Bond Donors | 14 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.56 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 14 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|