C10H11IN4 — CID 90708909
8-(cyclopropylmethyl)-7-iodo-[1,2,4]triazolo[4,3-a]pyridin-3-amine (PubChem CID 90708909) has the molecular formula C10H11IN4 and a molecular weight of 314.13 g/mol. Its IUPAC name is 8-(cyclopropylmethyl)-7-iodo-[1,2,4]triazolo[4,3-a]pyridin-3-amine.
| Compound Name | 8-(cyclopropylmethyl)-7-iodo-[1,2,4]triazolo[4,3-a]pyridin-3-amine |
|---|---|
| PubChem CID | 90708909 |
| Molecular Formula | C10H11IN4 |
| Molecular Weight | 314.13 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 8-(cyclopropylmethyl)-7-iodo-[1,2,4]triazolo[4,3-a]pyridin-3-amine |
| SMILES | Nc1nnc2c(CC3CC3)c(I)ccn12 |
| InChI | InChI=1S/C10H11IN4/c11-8-3-4-15-9(13-14-10(15)12)7(8)5-6-1-2-6/h3-4,6H,1-2,5H2,(H2,12,14) |
| InChIKey | KFYCYPNNQGVUHY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.13 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|