C38H52O2 — CID 90709140
(1R)-4-[18-[(1S,4R)-4-hydroxy-2-methylcyclohex-2-en-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-3,5,5-trimethylcyclohex-3-en-1-ol (PubChem CID 90709140) has the molecular formula C38H52O2 and a molecular weight of 540.83 g/mol. Its IUPAC name is (1R)-4-[18-[(1S,4R)-4-hydroxy-2-methylcyclohex-2-en-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-3,5,5-trimethylcyclohex-3-en-1-ol.
| Compound Name | (1R)-4-[18-[(1S,4R)-4-hydroxy-2-methylcyclohex-2-en-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-3,5,5-trimethylcyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 90709140 |
| Molecular Formula | C38H52O2 |
| Molecular Weight | 540.83 g/mol |
| Exact Mass | 540.40 |
| IUPAC Name | (1R)-4-[18-[(1S,4R)-4-hydroxy-2-methylcyclohex-2-en-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-3,5,5-trimethylcyclohex-3-en-1-ol |
| SMILES | CC(C=CC=C(C)C=CC1=C(C)C[C@@H](O)CC1(C)C)=CC=CC=C(C)C=CC=C(C)C=C[C@@H]1CC[C@@H](O)C=C1C |
| InChI | InChI=1S/C38H52O2/c1-28(15-11-17-30(3)19-21-34-22-23-35(39)25-32(34)5)13-9-10-14-29(2)16-12-18-31(4)20-24-37-33(6)26-36(40)27-38(37,7)8/h9-21,24-25,34-36,39-40H,22-23,26-27H2,1-8H3/t34-,35-,36-/m1/s1 |
| InChIKey | KCAIKHIQSZPKAJ-KUFDTJSHSA-N |
| XLogP | 9.77 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.83 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|