C23H30F6O6 — CID 90709234
1,1,1,3,3,3-hexafluoropropan-2-yl 3-(2,4-dimethyl-2-propan-2-ylpentanoyl)oxy-6-oxo-5-oxatricyclo[5.2.1.04,8]decane-7-carboxylate (PubChem CID 90709234) has the molecular formula C23H30F6O6 and a molecular weight of 516.48 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 3-(2,4-dimethyl-2-propan-2-ylpentanoyl)oxy-6-oxo-5-oxatricyclo[5.2.1.04,8]decane-7-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 3-(2,4-dimethyl-2-propan-2-ylpentanoyl)oxy-6-oxo-5-oxatricyclo[5.2.1.04,8]decane-7-carboxylate |
|---|---|
| PubChem CID | 90709234 |
| Molecular Formula | C23H30F6O6 |
| Molecular Weight | 516.48 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 3-(2,4-dimethyl-2-propan-2-ylpentanoyl)oxy-6-oxo-5-oxatricyclo[5.2.1.04,8]decane-7-carboxylate |
| SMILES | CC(C)CC(C)(C(=O)OC1CC2CC3C1OC(=O)C3(C(=O)OC(C(F)(F)F)C(F)(F)F)C2)C(C)C |
| InChI | InChI=1S/C23H30F6O6/c1-10(2)8-20(5,11(3)4)17(30)33-14-7-12-6-13-15(14)34-18(31)21(13,9-12)19(32)35-16(22(24,25)26)23(27,28)29/h10-16H,6-9H2,1-5H3 |
| InChIKey | VJDKEODTJHPJEH-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.48 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|