C27H23FN2O7 — CID 90709410
(4R,7R)-7-[2-(4-fluorophenoxy)ethyl]-4-methyl-2-(4-nitronaphthalen-1-yl)-5,6-dihydro-4,7-epoxyisoindole-1,3,5-triol (PubChem CID 90709410) has the molecular formula C27H23FN2O7 and a molecular weight of 506.49 g/mol. Its IUPAC name is (4R,7R)-7-[2-(4-fluorophenoxy)ethyl]-4-methyl-2-(4-nitronaphthalen-1-yl)-5,6-dihydro-4,7-epoxyisoindole-1,3,5-triol.
| Compound Name | (4R,7R)-7-[2-(4-fluorophenoxy)ethyl]-4-methyl-2-(4-nitronaphthalen-1-yl)-5,6-dihydro-4,7-epoxyisoindole-1,3,5-triol |
|---|---|
| PubChem CID | 90709410 |
| Molecular Formula | C27H23FN2O7 |
| Molecular Weight | 506.49 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | (4R,7R)-7-[2-(4-fluorophenoxy)ethyl]-4-methyl-2-(4-nitronaphthalen-1-yl)-5,6-dihydro-4,7-epoxyisoindole-1,3,5-triol |
| SMILES | C[C@]12O[C@](CCOc3ccc(F)cc3)(CC1O)c1c2c(O)n(-c2ccc([N+](=O)[O-])c3ccccc23)c1O |
| InChI | InChI=1S/C27H23FN2O7/c1-26-21(31)14-27(37-26,12-13-36-16-8-6-15(28)7-9-16)23-22(26)24(32)29(25(23)33)19-10-11-20(30(34)35)18-5-3-2-4-17(18)19/h2-11,21,31-33H,12-14H2,1H3/t21?,26-,27+/m0/s1 |
| InChIKey | FWVGXHOWJRNGNH-UZUUZLHTSA-N |
| XLogP | 4.76 |
| TPSA | 127.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|