C29H35F3N4O3S — CID 90709633
(1S,7S,8S)-4-[[(1R,2R)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-8-(trifluoromethyl)-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5,8-triol (PubChem CID 90709633) has the molecular formula C29H35F3N4O3S and a molecular weight of 576.69 g/mol. Its IUPAC name is (1S,7S,8S)-4-[[(1R,2R)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-8-(trifluoromethyl)-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5,8-triol.
| Compound Name | (1S,7S,8S)-4-[[(1R,2R)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-8-(trifluoromethyl)-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5,8-triol |
|---|---|
| PubChem CID | 90709633 |
| Molecular Formula | C29H35F3N4O3S |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | (1S,7S,8S)-4-[[(1R,2R)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-8-(trifluoromethyl)-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5,8-triol |
| SMILES | Oc1c2c(c(O)n1C[C@@H]1CCCC[C@H]1CN1CCN(c3nsc4ccccc34)CC1)[C@@H]1C[C@H]2C[C@@]1(O)C(F)(F)F |
| InChI | InChI=1S/C29H35F3N4O3S/c30-29(31,32)28(39)14-19-13-21(28)24-23(19)26(37)36(27(24)38)16-18-6-2-1-5-17(18)15-34-9-11-35(12-10-34)25-20-7-3-4-8-22(20)40-33-25/h3-4,7-8,17-19,21,37-39H,1-2,5-6,9-16H2/t17-,18-,19-,21-,28-/m0/s1 |
| InChIKey | JJZYPAGMZIOEBW-KQBDBNEBSA-N |
| XLogP | 5.41 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |