C16H17N3O — CID 9070990
4-amino-N-[(Z)-3-phenylpropylideneamino]benzamide (PubChem CID 9070990) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is 4-amino-N-[(Z)-3-phenylpropylideneamino]benzamide.
| Compound Name | 4-amino-N-[(Z)-3-phenylpropylideneamino]benzamide |
|---|---|
| PubChem CID | 9070990 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 4-amino-N-[(Z)-3-phenylpropylideneamino]benzamide |
| SMILES | Nc1ccc(C(=O)N/N=C\CCc2ccccc2)cc1 |
| InChI | InChI=1S/C16H17N3O/c17-15-10-8-14(9-11-15)16(20)19-18-12-4-7-13-5-2-1-3-6-13/h1-3,5-6,8-12H,4,7,17H2,(H,19,20)/b18-12- |
| InChIKey | KAERUIACODBLGV-PDGQHHTCSA-N |
| XLogP | 2.62 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|