C28H31FO3 — CID 90710029
ethyl 5-[(1S,2S)-2-[7-(4-fluorophenyl)-3,3-dimethyl-2H-1-benzofuran-5-yl]-2-methylcyclopropyl]-3-methylpenta-2,4-dienoate (PubChem CID 90710029) has the molecular formula C28H31FO3 and a molecular weight of 434.55 g/mol. Its IUPAC name is ethyl 5-[(1S,2S)-2-[7-(4-fluorophenyl)-3,3-dimethyl-2H-1-benzofuran-5-yl]-2-methylcyclopropyl]-3-methylpenta-2,4-dienoate.
| Compound Name | ethyl 5-[(1S,2S)-2-[7-(4-fluorophenyl)-3,3-dimethyl-2H-1-benzofuran-5-yl]-2-methylcyclopropyl]-3-methylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 90710029 |
| Molecular Formula | C28H31FO3 |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | ethyl 5-[(1S,2S)-2-[7-(4-fluorophenyl)-3,3-dimethyl-2H-1-benzofuran-5-yl]-2-methylcyclopropyl]-3-methylpenta-2,4-dienoate |
| SMILES | CCOC(=O)C=C(C)C=C[C@@H]1C[C@]1(C)c1cc(-c2ccc(F)cc2)c2c(c1)C(C)(C)CO2 |
| InChI | InChI=1S/C28H31FO3/c1-6-31-25(30)13-18(2)7-10-20-16-28(20,5)21-14-23(19-8-11-22(29)12-9-19)26-24(15-21)27(3,4)17-32-26/h7-15,20H,6,16-17H2,1-5H3/t20-,28+/m1/s1 |
| InChIKey | KPCSGBYYVQGGAT-NGOKVRLYSA-N |
| XLogP | 6.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|